|
CAS#: 6537-90-2 Product: 3a,6,7,7alpha-Tetrahydro-4,7-Ethanoisobenzofuran-1,3,5,9(4H)-Tetrone No suppilers available for the product. |
| Name | 3a,6,7,7alpha-Tetrahydro-4,7-Ethanoisobenzofuran-1,3,5,9(4H)-Tetrone |
|---|---|
| Synonyms | Bicyclo[2.2.2]Octane-2,3-Dicarboxylic Anhydride, 5,7-Dioxo-; Nsc120525 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.17 |
| CAS Registry Number | 6537-90-2 |
| SMILES | O=C1C2C3C(C(C1)C(=O)C2)C(OC3=O)=O |
| InChI | 1S/C10H8O5/c11-5-1-3-6(12)2-4(5)8-7(3)9(13)15-10(8)14/h3-4,7-8H,1-2H2 |
| InChIKey | DOEBRZGMLPHNHL-UHFFFAOYSA-N |
| Density | 1.551g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.805°C at 760 mmHg (Cal.) |
| Flash point | 225.501°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3a,6,7,7alpha-Tetrahydro-4,7-Ethanoisobenzofuran-1,3,5,9(4H)-Tetrone |