|
CAS#: 65400-36-4 Product: 1,2-Dihydroxy-7H-dibenzo[de,g]quinolin-7-one No suppilers available for the product. |
| Name | 1,2-Dihydroxy-7H-dibenzo[de,g]quinolin-7-one |
|---|---|
| Synonyms | Liriodendromine; 7H-Dibenzo(De,G)Quinolin-7-One, 1,2-Dihydroxy-; 1,2-Dihydroxy-7H-Dibenzo[De,G]Quinolin-7-One |
| Molecular Structure | ![]() |
| Molecular Formula | C16H9NO3 |
| Molecular Weight | 263.25 |
| CAS Registry Number | 65400-36-4 |
| SMILES | C2=C1C4=C3C(=C(O)C1=CC=C2)NC=CC3=CC(=O)C4=O |
| InChI | 1S/C16H9NO3/c18-11-7-8-5-6-17-14-12(8)13(16(11)20)9-3-1-2-4-10(9)15(14)19/h1-7,17,19H |
| InChIKey | QLIKXXBOGDPNGC-UHFFFAOYSA-N |
| Density | 1.556g/cm3 (Cal.) |
|---|---|
| Boiling point | 566.642°C at 760 mmHg (Cal.) |
| Flash point | 296.495°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydroxy-7H-dibenzo[de,g]quinolin-7-one |