|
CAS#: 65416-59-3 Product: 2,10,10-Trimethyl-6-Methylene-1-Oxaspiro[4.5]Dec-7-Ene No suppilers available for the product. |
| Name | 2,10,10-Trimethyl-6-Methylene-1-Oxaspiro[4.5]Dec-7-Ene |
|---|---|
| Synonyms | 2,6,6-Trimethyl-10-Methylene-1-Oxaspiro[4.5]Dec-8-Ene; Vitispirane; 1-Oxaspiro(4.5)Dec-7-Ene, 2,10,10-Trimethyl-6-Methylene- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 65416-59-3 |
| SMILES | CC2(C1(OC(C)CC1)C(C=CC2)=C)C |
| InChI | 1S/C13H20O/c1-10-6-5-8-12(3,4)13(10)9-7-11(2)14-13/h5-6,11H,1,7-9H2,2-4H3 |
| InChIKey | DUPDJVDPPBFBPL-UHFFFAOYSA-N |
| Density | 0.952g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.732°C at 760 mmHg (Cal.) |
| Flash point | 106.711°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,10,10-Trimethyl-6-Methylene-1-Oxaspiro[4.5]Dec-7-Ene |