|
CAS#: 65438-08-6 Product: 2,3-Dimercaptobutanedioic Acid Technetium-99 Salt No suppilers available for the product. |
| Name | 2,3-Dimercaptobutanedioic Acid Technetium-99 Salt |
|---|---|
| Synonyms | 2,3-Dimercaptobutanedioic Acid; Technetium; 2,3-Dimercaptosuccinic Acid; Technetium; 99Tc-Succimer |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6O4S2Tc |
| Molecular Weight | 281.12 |
| CAS Registry Number | 65438-08-6 |
| SMILES | [99Tc].O=C(C(S)C(S)C(O)=O)O |
| InChI | 1S/C4H6O4S2.Tc/c5-3(6)1(9)2(10)4(7)8;/h1-2,9-10H,(H,5,6)(H,7,8);/i;1+1 |
| InChIKey | UEGHKGHBANZTIM-IEOVAKBOSA-N |
| Boiling point | 267.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 115.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimercaptobutanedioic Acid Technetium-99 Salt |