Online Database of Chemicals from Around the World
| Sinova Corporation | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (301) 961-1525 | |||
 |
sales@sinovainc.com | |||
| Chemical manufacturer | ||||
| Name | 6-(Trifluoromethyl)-1H-Indazol-3-Ol |
|---|---|
| Synonyms | 3H-Indazol-3-one, 1,2-dihydro-6-(trifluoromethyl)-; 3-Hydroxy-6-trifluromethyl (1H)indazole; 6-(Trifluormethyl)-1,2-dihydro-3H-indazol-3-on |
| Molecular Structure |  |
| Molecular Formula | C8H5F3N2O |
| Molecular Weight | 202.13 |
| CAS Registry Number | 655-96-9 |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)NN=C2O |
| InChI | 1S/C8H5F3N2O/c9-8(10,11)4-1-2-5-6(3-4)12-13-7(5)14/h1-3H,(H2,12,13,14) |
| InChIKey | QCNQBLFRKWASJA-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 264-266°C (Expl.) |
| Boiling point | 347.8±37.0°C at 760 mmHg (Cal.) |
| Flash point | 164.1±26.5°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-(Trifluoromethyl)-1H-Indazol-3-Ol |