|
CAS#: 65509-24-2 Product: Maroxepin No suppilers available for the product. |
| Name | Maroxepin |
|---|---|
| Synonyms | 2,3,4,5-Tetrahydro-3-Methyl-1H-Dibenz(2,3:6,7)Oxepino(4,5-D)Azepine; Maroxepin; Maroxepin [Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 |
| CAS Registry Number | 65509-24-2 |
| SMILES | C1=CC=CC3=C1C4=C(C2=C(C=CC=C2)O3)CCN(CC4)C |
| InChI | 1S/C19H19NO/c1-20-12-10-14-15(11-13-20)17-7-3-5-9-19(17)21-18-8-4-2-6-16(14)18/h2-9H,10-13H2,1H3 |
| InChIKey | RLYFYCIACXEKPZ-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.152°C at 760 mmHg (Cal.) |
| Flash point | 125.166°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Maroxepin |