|
CAS#: 65529-87-5 Product: 7,8,8-Trimethyl-4,7-Methano-2H-Indazole No suppilers available for the product. |
| Name | 7,8,8-Trimethyl-4,7-Methano-2H-Indazole |
|---|---|
| Synonyms | 7,8,8-Trimethyl-4,7-Methano-2H-Indazole; (4S,7R)-4,7-Methano-2H-Indazole; 4,7-M(2H)Idz |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 |
| CAS Registry Number | 65529-87-5 |
| SMILES | [C@@]12(C([C@H](CC1)C3=C2[NH]N=C3)(C)C)C |
| InChI | 1S/C11H16N2/c1-10(2)8-4-5-11(10,3)9-7(8)6-12-13-9/h6,8H,4-5H2,1-3H3,(H,12,13)/t8-,11+/m1/s1 |
| InChIKey | IQTIQGVRWRCLOK-KCJUWKMLSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.77°C at 760 mmHg (Cal.) |
| Flash point | 123.85°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8,8-Trimethyl-4,7-Methano-2H-Indazole |