|
CAS#: 65561-77-5 Product: (1R,3R,4S,5R)-3-[(4S)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]-7,7-Dimethyl-2,6,8-Trioxabicyclo[3.3.0]Octan-4-Ol No suppilers available for the product. |
| Name | (1R,3R,4S,5R)-3-[(4S)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]-7,7-Dimethyl-2,6,8-Trioxabicyclo[3.3.0]Octan-4-Ol |
|---|---|
| Synonyms | Glucofuranose, 1:2,5:6-Di-O-Isopropylidene-, Alpha-D-; Nsc 1223 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 |
| CAS Registry Number | 65561-77-5 |
| EINECS | 209-486-0 |
| SMILES | [C@H]12OC(O[C@H]1O[C@@H]([C@@H]2O)[C@H]3OC(OC3)(C)C)(C)C |
| InChI | 1S/C12H20O6/c1-11(2)14-5-6(16-11)8-7(13)9-10(15-8)18-12(3,4)17-9/h6-10,13H,5H2,1-4H3/t6-,7-,8+,9+,10+/m0/s1 |
| InChIKey | KEJGAYKWRDILTF-SRQGCSHVSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.753°C at 760 mmHg (Cal.) |
| Flash point | 173.187°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,3R,4S,5R)-3-[(4S)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]-7,7-Dimethyl-2,6,8-Trioxabicyclo[3.3.0]Octan-4-Ol |