|
CAS#: 65698-59-1 Product: 10-Methylphenanthrene-9-Carboxylic Acid No suppilers available for the product. |
| Name | 10-Methylphenanthrene-9-Carboxylic Acid |
|---|---|
| Synonyms | 10-Methyl-9-Phenanthrenecarboxylic Acid; Nsc241163 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 65698-59-1 |
| SMILES | C1=CC2=C(C=C1)C(=C(C3=C2C=CC=C3)C(=O)O)C |
| InChI | 1S/C16H12O2/c1-10-11-6-2-3-7-12(11)13-8-4-5-9-14(13)15(10)16(17)18/h2-9H,1H3,(H,17,18) |
| InChIKey | ZKDABOISAFEPOA-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.699°C at 760 mmHg (Cal.) |
| Flash point | 199.04°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Methylphenanthrene-9-Carboxylic Acid |