|
CAS#: 65733-76-8 Product: 4-(1,1-Dimethylethyl)phenol, polymer with formaldehyde and 4-(1,1-dimethylpropyl)phenol No suppilers available for the product. |
| Name | 4-(1,1-Dimethylethyl)phenol, polymer with formaldehyde and 4-(1,1-dimethylpropyl)phenol |
|---|---|
| Synonyms | 4-Tert-Butylphenol; 4-(1,1-Dimethylpropyl)Phenol; Formaldehyde; 4-Tert-Amylphenol; 4-Tert-Butylphenol; Formaldehyde |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.49 |
| CAS Registry Number | 65733-76-8 |
| SMILES | C1=CC(=CC=C1O)C(C)(C)C.O=C.C(C(C2=CC=C(C=C2)O)(C)C)C |
| InChI | 1S/C11H16O.C10H14O.CH2O/c1-4-11(2,3)9-5-7-10(12)8-6-9;1-10(2,3)8-4-6-9(11)7-5-8;1-2/h5-8,12H,4H2,1-3H3;4-7,11H,1-3H3;1H2 |
| InChIKey | AZTCPXTVBNAPNF-UHFFFAOYSA-N |
| Boiling point | 262.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 122.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1,1-Dimethylethyl)phenol, polymer with formaldehyde and 4-(1,1-dimethylpropyl)phenol |