|
CAS#: 65776-65-0 Product: N-(3-Bromo-2-Naphthyl)Ethanethioamide No suppilers available for the product. |
| Name | N-(3-Bromo-2-Naphthyl)Ethanethioamide |
|---|---|
| Synonyms | N-(3-Bromo-2-Naphthyl)Thioacetamide; Ethanethioamide, N-(3-Bromo-2-Naphthalenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10BrNS |
| Molecular Weight | 280.18 |
| CAS Registry Number | 65776-65-0 |
| EINECS | 265-923-5 |
| SMILES | C2=C1C=CC=CC1=CC(=C2Br)NC(=S)C |
| InChI | 1S/C12H10BrNS/c1-8(15)14-12-7-10-5-3-2-4-9(10)6-11(12)13/h2-7H,1H3,(H,14,15) |
| InChIKey | GJYSHKHREVFSIB-UHFFFAOYSA-N |
| Density | 1.551g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.006°C at 760 mmHg (Cal.) |
| Flash point | 182.412°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Bromo-2-Naphthyl)Ethanethioamide |