|
CAS#: 658-90-2 Product: 3-(Trifluoromethoxy)Benzoyl Fluoride No suppilers available for the product. |
| Name | 3-(Trifluoromethoxy)Benzoyl Fluoride |
|---|---|
| Synonyms | Benzoyl Fluoride, 3-(Trifluoromethoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.11 |
| CAS Registry Number | 658-90-2 |
| EINECS | 211-526-7 |
| SMILES | C1=C(C=CC=C1C(=O)F)OC(F)(F)F |
| InChI | 1S/C8H4F4O2/c9-7(13)5-2-1-3-6(4-5)14-8(10,11)12/h1-4H |
| InChIKey | XRRBDBIQJMJLJV-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 175.035°C at 760 mmHg (Cal.) |
| Flash point | 58.514°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Trifluoromethoxy)Benzoyl Fluoride |