|
CAS#: 65935-72-0 Product: 4-(2-(1,2,3,5,6,7-Hexahydro-S-indacen-4-yl)-2-oxo-1-thioxoethyl)-Morpholine No suppilers available for the product. |
| Name | 4-(2-(1,2,3,5,6,7-Hexahydro-S-indacen-4-yl)-2-oxo-1-thioxoethyl)-Morpholine |
|---|---|
| Synonyms | 1-(1,2,3,5,6,7-Hexahydro-S-Indacen-4-Yl)-2-Morpholino-2-Thioxo-Ethanone; 1-(1,2,3,5,6,7-Hexahydro-S-Indacen-4-Yl)-2-Morpholino-2-Thioxoethanone; 1-(1,2,3,5,6,7-Hexahydro-S-Indacen-4-Yl)-2-Morpholin-4-Yl-2-Sulfanylidene-Ethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.43 |
| CAS Registry Number | 65935-72-0 |
| SMILES | C2=C4C(=C(C(C(N1CCOCC1)=S)=O)C3=C2CCC3)CCC4 |
| InChI | 1S/C18H21NO2S/c20-17(18(22)19-7-9-21-10-8-19)16-14-5-1-3-12(14)11-13-4-2-6-15(13)16/h11H,1-10H2 |
| InChIKey | SZKUGAZCYYUKFQ-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.924°C at 760 mmHg (Cal.) |
| Flash point | 271.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-(1,2,3,5,6,7-Hexahydro-S-indacen-4-yl)-2-oxo-1-thioxoethyl)-Morpholine |