Online Database of Chemicals from Around the World
|
CAS#: 65982-33-4 Product: 4,4-Dimethylergosta-8,24(28)-dien-3-ol No suppilers available for the product. |
| Name | 4,4-Dimethylergosta-8,24(28)-dien-3-ol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.72 |
| CAS Registry Number | 65982-33-4 |
| SMILES | CC(C)C(=C)CC[C@@H](C)[C@H]2CC[C@H]3C=4CCC1C(C)(C)C(O)CC[C@]1(C)C=4CC[C@]23C |
| InChI | 1S/C30H50O/c1-19(2)20(3)9-10-21(4)23-12-13-24-22-11-14-26-28(5,6)27(31)16-18-30(26,8)25(22)15-17-29(23,24)7/h19,21,23-24,26-27,31H,3,9-18H2,1-2,4-8H3/t21-,23-,24+,26?,27?,29-,30-/m1/s1 |
| InChIKey | UEWBRSZKEWLYPN-RVVLRZIRSA-N |
| Density | 0.982g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.429°C at 760 mmHg (Cal.) |
| Flash point | 222.173°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethylergosta-8,24(28)-dien-3-ol |