Online Database of Chemicals from Around the World
|
CAS#: 66008-69-3 Product: 2-(N-(1,1-Dihydroperfluorononylsulfonyl)-N-methylamino)ethyl acrylate No suppilers available for the product. |
| Name | 2-(N-(1,1-Dihydroperfluorononylsulfonyl)-N-methylamino)ethyl acrylate |
|---|---|
| Synonyms | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononylsulfonyl-Methyl-Amino)Ethyl Prop-2-Enoate; Prop-2-Enoic Acid 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononylsulfonyl-Methylamino)Ethyl Ester; Acrylic Acid 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononylsulfonyl-Methyl-Amino)Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C15H12F17NO4S |
| Molecular Weight | 625.30 |
| CAS Registry Number | 66008-69-3 |
| EINECS | 266-060-7 |
| SMILES | C(N([S](=O)(=O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C)COC(=O)C=C |
| InChI | 1S/C15H12F17NO4S/c1-3-7(34)37-5-4-33(2)38(35,36)6-8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h3H,1,4-6H2,2H3 |
| InChIKey | PIINPBJRTIJQBX-UHFFFAOYSA-N |
| Density | 1.579g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.436°C at 760 mmHg (Cal.) |
| Flash point | 182.067°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(N-(1,1-Dihydroperfluorononylsulfonyl)-N-methylamino)ethyl acrylate |