|
CAS#: 66018-79-9 Product: 2,5-Dimethyl-Phenol Phenylcarbamate No suppilers available for the product. |
| Name | 2,5-Dimethyl-Phenol Phenylcarbamate |
|---|---|
| Synonyms | N-Phenylcarbamic Acid (2,5-Dimethylphenyl) Ester; 2,5-Dimethylphenyl-N-Phenylcarbamate; Nsc77059 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 |
| CAS Registry Number | 66018-79-9 |
| SMILES | C1=CC(=CC(=C1C)OC(NC2=CC=CC=C2)=O)C |
| InChI | 1S/C15H15NO2/c1-11-8-9-12(2)14(10-11)18-15(17)16-13-6-4-3-5-7-13/h3-10H,1-2H3,(H,16,17) |
| InChIKey | PVVMDLAHKBYBFL-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.069°C at 760 mmHg (Cal.) |
| Flash point | 167.331°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethyl-Phenol Phenylcarbamate |