|
CAS#: 660397-17-1 Product: Methyl 4-hydroxy-5-oxo-L-prolinate No suppilers available for the product. |
| Name | Methyl 4-hydroxy-5-oxo-L-prolinate |
|---|---|
| Synonyms | (2S)-methyl 4-hydroxy-5-oxopyrrolidine-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 |
| CAS Registry Number | 660397-17-1 |
| SMILES | COC(=O)[C@@H]1CC(C(=O)N1)O |
| InChI | 1S/C6H9NO4/c1-11-6(10)3-2-4(8)5(9)7-3/h3-4,8H,2H2,1H3,(H,7,9)/t3-,4?/m0/s1 |
| InChIKey | OKJQBJHYKVHRIS-WUCPZUCCSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.722°C at 760 mmHg (Cal.) |
| Flash point | 185.869°C (Cal.) |
| Refractive index | 1.507 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-hydroxy-5-oxo-L-prolinate |