|
CAS#: 66054-53-3 Product: 2-Amino-3,4,5,7,8,9,10-heptahydroxyundecanedial No suppilers available for the product. |
| Name | 2-Amino-3,4,5,7,8,9,10-heptahydroxyundecanedial |
|---|---|
| Synonyms | 2-Amino-3,4,5,7,8,9,10-Heptahydroxy-Undecanedial; Tunicamine; L-Allo-D-Galacto-Undecodialdose, 2-Amino-2,6-Dideoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H21NO9 |
| Molecular Weight | 311.29 |
| CAS Registry Number | 66054-53-3 |
| SMILES | C(C(C(C(C(C=O)N)O)O)O)C(C(C(C(C=O)O)O)O)O |
| InChI | 1S/C11H21NO9/c12-4(2-13)8(18)9(19)5(15)1-6(16)10(20)11(21)7(17)3-14/h2-11,15-21H,1,12H2 |
| InChIKey | WYCVCBXIFGHWMA-UHFFFAOYSA-N |
| Density | 1.605g/cm3 (Cal.) |
|---|---|
| Boiling point | 744.403°C at 760 mmHg (Cal.) |
| Flash point | 404.001°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-3,4,5,7,8,9,10-heptahydroxyundecanedial |