|
CAS#: 6609-49-0 Product: 2,4-Dichloro-6-Nitrophenolammonium No suppilers available for the product. |
| Name | 2,4-Dichloro-6-Nitrophenolammonium |
|---|---|
| Synonyms | Ammonium 2,4-Dichloro-6-Nitro-Phenolate; Ammonium 2,4-Dichloro-6-Nitrophenolate; Azanium 2,4-Dichloro-6-Nitro-Phenolate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6Cl2N2O3 |
| Molecular Weight | 225.03 |
| CAS Registry Number | 6609-49-0 |
| SMILES | C1=C([N+]([O-])=O)C(=C(Cl)C=C1Cl)[O-].[NH4+] |
| InChI | 1S/C6H3Cl2NO3.H3N/c7-3-1-4(8)6(10)5(2-3)9(11)12;/h1-2,10H;1H3 |
| InChIKey | NZBTWNCDMYUIQL-UHFFFAOYSA-N |
| Boiling point | 242.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 100.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-6-Nitrophenolammonium |