|
CAS#: 66104-42-5 Product: Disodium N-[(p-Tolyl)Sulphonyl]-L-Glutamate No suppilers available for the product. |
| Name | Disodium N-[(p-Tolyl)Sulphonyl]-L-Glutamate |
|---|---|
| Synonyms | Disodium (2S)-2-[(4-Methylphenyl)Sulfonylamino]Glutarate; Disodium N-((P-Tolyl)Sulphonyl)-L-Glutamate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NNa2O6S |
| Molecular Weight | 345.28 |
| CAS Registry Number | 66104-42-5 |
| EINECS | 266-148-5 |
| SMILES | [C@@H](N[S](=O)(=O)C1=CC=C(C=C1)C)(C([O-])=O)CCC([O-])=O.[Na+].[Na+] |
| InChI | 1S/C12H15NO6S.2Na/c1-8-2-4-9(5-3-8)20(18,19)13-10(12(16)17)6-7-11(14)15;;/h2-5,10,13H,6-7H2,1H3,(H,14,15)(H,16,17);;/q;2*+1/p-2/t10-;;/m0../s1 |
| InChIKey | HEBHJTRJCWUUQW-XRIOVQLTSA-L |
| Boiling point | 534.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 276.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium N-[(p-Tolyl)Sulphonyl]-L-Glutamate |