Online Database of Chemicals from Around the World
|
CAS#: 66125-72-2 Product: 2,2-Diethyl-2,3,5,10-tetrahydro-1H-pyrazolo(1,2-b)phthalazine-1,3-dione No suppilers available for the product. |
| Name | 2,2-Diethyl-2,3,5,10-tetrahydro-1H-pyrazolo(1,2-b)phthalazine-1,3-dione |
|---|---|
| Synonyms | 2,2-Diethyl-5,10-Dihydropyrazolo[1,2-B]Phthalazine-1,3-Quinone; 2,2-Diethyl-2,3,5,10-Tetrahydro-1H-Pyrazolo(1,2-B)Phthalazine-1,3-Dione; 2,2-Dietil-2,3,5,10-Tetraidro-1H-Pirazolo(1,2-B)Ftalazin-1,3-Dione [Italian] |
| Molecular Structure |  |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 |
| CAS Registry Number | 66125-72-2 |
| SMILES | C1=CC=CC3=C1CN2C(C(C(N2C3)=O)(CC)CC)=O |
| InChI | 1S/C15H18N2O2/c1-3-15(4-2)13(18)16-9-11-7-5-6-8-12(11)10-17(16)14(15)19/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | LFQMTRPJSNJBCF-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.916°C at 760 mmHg (Cal.) |
| Flash point | 155.382°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Diethyl-2,3,5,10-tetrahydro-1H-pyrazolo(1,2-b)phthalazine-1,3-dione |