|
CAS#: 66142-21-0 Product: 4-Methoxy-2-(4-Methoxyphenyl)-1-Benzopyrylium Methyl Sulphate No suppilers available for the product. |
| Name | 4-Methoxy-2-(4-Methoxyphenyl)-1-Benzopyrylium Methyl Sulphate |
|---|---|
| Synonyms | [2-(4-Methoxyphenyl)Chromen-4-Ylidene]-Methyl-Oxonium; Methyl Sulfate; [2-(4-Methoxyphenyl)-4-Chromenylidene]-Methyloxonium; Methyl Sulfate; [2-(4-Methoxyphenyl)Chromen-4-Ylidene]-Methyl-Oxidanium; Methyl Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18O7S |
| Molecular Weight | 378.40 |
| CAS Registry Number | 66142-21-0 |
| EINECS | 266-179-4 |
| SMILES | [O+]1=C3C(=C(OC)C=C1C2=CC=C(OC)C=C2)C=CC=C3.CO[S]([O-])(=O)=O |
| InChI | 1S/C17H15O3.CH4O4S/c1-18-13-9-7-12(8-10-13)16-11-17(19-2)14-5-3-4-6-15(14)20-16;1-5-6(2,3)4/h3-11H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | ICMZUJFDLZSYOS-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-2-(4-Methoxyphenyl)-1-Benzopyrylium Methyl Sulphate |