|
CAS#: 6616-05-3 Product: 3,7-Dihydro-1,3-Dimethyl-8-(Propylthio)-1H-Purine-2,6-Dithione No suppilers available for the product. |
| Name | 3,7-Dihydro-1,3-Dimethyl-8-(Propylthio)-1H-Purine-2,6-Dithione |
|---|---|
| Synonyms | 1,3-Dimethyl-8-(Propylthio)-7H-Purine-2,6-Dithione; Uric Acid, 1,3-Dimethyl-2,6-Dithio-8-Propylthio-; Nciopen2_006258 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N4S3 |
| Molecular Weight | 286.43 |
| CAS Registry Number | 6616-05-3 |
| SMILES | C(SC2=NC1=C(C(N(C)C(N1C)=S)=S)[NH]2)CC |
| InChI | 1S/C10H14N4S3/c1-4-5-17-9-11-6-7(12-9)13(2)10(16)14(3)8(6)15/h4-5H2,1-3H3,(H,11,12) |
| InChIKey | IPBFBAWZCNXDPU-UHFFFAOYSA-N |
| Density | 1.466g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.984°C at 760 mmHg (Cal.) |
| Flash point | 242.271°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dihydro-1,3-Dimethyl-8-(Propylthio)-1H-Purine-2,6-Dithione |