|
CAS#: 6617-34-1 Product: 3,7,7-Trimethylbicyclo[4.1.0]Hept-3-Ene-2,5-Dione No suppilers available for the product. |
| Name | 3,7,7-Trimethylbicyclo[4.1.0]Hept-3-Ene-2,5-Dione |
|---|---|
| Synonyms | 3,7,7-Trimethylbicyclo[4.1.0]Hept-3-Ene-2,5-Quinone; Bicyclo(4.1.0)Hept-3-Ene-2,5-Dione, 3,7,7-Trimethyl-, Cis-; Car-3-Ene-2,5-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 |
| CAS Registry Number | 6617-34-1 |
| SMILES | CC1(C2C1C(=O)C(=CC2=O)C)C |
| InChI | 1S/C10H12O2/c1-5-4-6(11)7-8(9(5)12)10(7,2)3/h4,7-8H,1-3H3 |
| InChIKey | BBRJZZUFDYMNIY-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.256°C at 760 mmHg (Cal.) |
| Flash point | 93.641°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7,7-Trimethylbicyclo[4.1.0]Hept-3-Ene-2,5-Dione |