|
CAS#: 66225-86-3 Product: Technetium Tc 99M Dimethylaminomethylene Diphosphonate No suppilers available for the product. |
| Name | Technetium Tc 99M Dimethylaminomethylene Diphosphonate |
|---|---|
| Synonyms | N-(Diphosphonatomethyl)-N-Methyl-Methanamine; Technetium(+4) Cation; Diphosphonatomethyl-Dimethyl-Amine; Technetium(+4) Cation; Phosphonic Acid, ((Dimethylamino)Methylene)Bis-, Technitium-99Tc Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C3H7NO6P2Tc |
| Molecular Weight | 313.95 |
| CAS Registry Number | 66225-86-3 |
| SMILES | [99Tc+4].CN(C([P]([O-])([O-])=O)[P]([O-])([O-])=O)C |
| InChI | 1S/C3H11NO6P2.Tc/c1-4(2)3(11(5,6)7)12(8,9)10;/h3H,1-2H3,(H2,5,6,7)(H2,8,9,10);/q;+4/p-4/i;1+1 |
| InChIKey | ZOJUMWGVWSIJAZ-IEOVAKBOSA-J |
| Boiling point | 490.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 250.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Technetium Tc 99M Dimethylaminomethylene Diphosphonate |