|
CAS#: 6623-93-4 Product: 4-(1-Methyl-1-Phenyl-Ethyl)-Anisole No suppilers available for the product. |
| Name | 4-(1-Methyl-1-Phenyl-Ethyl)-Anisole |
|---|---|
| Synonyms | 1-Methoxy-4-(1-Methyl-1-Phenyl-Ethyl)Benzene; 1-Methoxy-4-(1-Methyl-1-Phenylethyl)Benzene; Inchi=1/C16h18o/C1-16(2,13-7-5-4-6-8-13)14-9-11-15(17-3)12-10-14/H4-12H,1-3H |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 |
| CAS Registry Number | 6623-93-4 |
| SMILES | C2=C(C(C1=CC=CC=C1)(C)C)C=CC(=C2)OC |
| InChI | 1S/C16H18O/c1-16(2,13-7-5-4-6-8-13)14-9-11-15(17-3)12-10-14/h4-12H,1-3H3 |
| InChIKey | QFRZPXZJXKYCIW-UHFFFAOYSA-N |
| Density | 0.998g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.535°C at 760 mmHg (Cal.) |
| Flash point | 127.259°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1-Methyl-1-Phenyl-Ethyl)-Anisole |