Online Database of Chemicals from Around the World
|
CAS#: 66264-74-2 Product: 4-Acetyl-2-(Methylthio)Phenyl Benzoate No suppilers available for the product. |
| Name | 4-Acetyl-2-(Methylthio)Phenyl Benzoate |
|---|---|
| Synonyms | (4-Acetyl-2-Methylsulfanyl-Phenyl) Benzoate; Benzoic Acid [4-Acetyl-2-(Methylthio)Phenyl] Ester; (4-Ethanoyl-2-Methylsulfanyl-Phenyl) Benzoate |
| Molecular Structure |  |
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.34 |
| CAS Registry Number | 66264-74-2 |
| EINECS | 266-288-7 |
| SMILES | C1=C(C=CC(=C1SC)OC(=O)C2=CC=CC=C2)C(=O)C |
| InChI | 1S/C16H14O3S/c1-11(17)13-8-9-14(15(10-13)20-2)19-16(18)12-6-4-3-5-7-12/h3-10H,1-2H3 |
| InChIKey | HIGPVCJXNZADEZ-UHFFFAOYSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.069°C at 760 mmHg (Cal.) |
| Flash point | 244.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Acetyl-2-(Methylthio)Phenyl Benzoate |