|
CAS#: 66277-11-0 Product: 19-Iodocholesterol 3-Methyl Ether No suppilers available for the product. |
| Name | 19-Iodocholesterol 3-Methyl Ether |
|---|---|
| Synonyms | (3S,8S,9S,10S,13R,14S,17R)-17-[(1R)-1,5-Dimethylhexyl]-10-(Iodomethyl)-3-Methoxy-13-Methyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthrene; 19-Iodocholesterol 3-Methyl Ether; Cholest-5-Ene, 19-Iodo-3-Methoxy-, (3Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C28H47IO |
| Molecular Weight | 526.58 |
| CAS Registry Number | 66277-11-0 |
| SMILES | [C@H]34[C@H]1[C@@H]([C@@]2(C(=CC1)C[C@@H](OC)CC2)CI)CC[C@@]3([C@H](CC4)[C@@H](CCCC(C)C)C)C |
| InChI | 1S/C28H47IO/c1-19(2)7-6-8-20(3)24-11-12-25-23-10-9-21-17-22(30-5)13-16-28(21,18-29)26(23)14-15-27(24,25)4/h9,19-20,22-26H,6-8,10-18H2,1-5H3/t20-,22+,23+,24-,25+,26+,27-,28-/m1/s1 |
| InChIKey | AFIXDOPRDJZNOO-TURLQYGPSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.683°C at 760 mmHg (Cal.) |
| Flash point | 271.724°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 19-Iodocholesterol 3-Methyl Ether |