|
CAS#: 66292-53-3 Product: Iprofenin No suppilers available for the product. |
| Name | Iprofenin |
|---|---|
| Synonyms | 2-[Carboxymethyl-[2-[(4-Isopropylphenyl)Amino]-2-Oxo-Ethyl]Amino]Acetic Acid; 2-[Carboxymethyl-[2-[(4-Isopropylphenyl)Amino]-2-Oxoethyl]Amino]Acetic Acid; 2-[Carboxymethyl-[2-[(4-Isopropylphenyl)Amino]-2-Keto-Ethyl]Amino]Acetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 |
| CAS Registry Number | 66292-53-3 |
| SMILES | C1=C(C=CC(=C1)NC(CN(CC(O)=O)CC(=O)O)=O)C(C)C |
| InChI | 1S/C15H20N2O5/c1-10(2)11-3-5-12(6-4-11)16-13(18)7-17(8-14(19)20)9-15(21)22/h3-6,10H,7-9H2,1-2H3,(H,16,18)(H,19,20)(H,21,22) |
| InChIKey | FPTRWYHXARAFPO-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 576.837°C at 760 mmHg (Cal.) |
| Flash point | 302.66°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Iprofenin |