|
CAS#: 6630-42-8 Product: alpha-Chloro-beta-Imidazol-4(5)-Ylpropionic Acid No suppilers available for the product. |
| Name | alpha-Chloro-beta-Imidazol-4(5)-Ylpropionic Acid |
|---|---|
| Synonyms | 2-Chloro-3-(3H-Imidazol-4-Yl)Propionic Acid; Alpha-Chloro-Beta-Imidazol-4(5)-Ylpropionic Acid; Nsc315287 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7ClN2O2 |
| Molecular Weight | 174.59 |
| CAS Registry Number | 6630-42-8 |
| SMILES | C1=NC=C(CC(Cl)C(=O)O)[NH]1 |
| InChI | 1S/C6H7ClN2O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1H2,(H,8,9)(H,10,11) |
| InChIKey | JZLQYMHAXPPICX-UHFFFAOYSA-N |
| Density | 1.496g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.204°C at 760 mmHg (Cal.) |
| Flash point | 226.68°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Chloro-beta-Imidazol-4(5)-Ylpropionic Acid |