|
CAS#: 66324-82-1 Product: (1-Methylethyl)-2,3-Dihydro-4-Methyl-2-1H-Indene No suppilers available for the product. |
| Name | (1-Methylethyl)-2,3-Dihydro-4-Methyl-2-1H-Indene |
|---|---|
| Synonyms | 2-Isopropyl-4-Methyl-Indane; 2-Isopropyl-4-Methylindane; 1H-Indene, 2,3-Dihydro-4-Methyl-2-(1-Methylethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 |
| CAS Registry Number | 66324-82-1 |
| SMILES | C1=CC=C(C)C2=C1CC(C(C)C)C2 |
| InChI | 1S/C13H18/c1-9(2)12-7-11-6-4-5-10(3)13(11)8-12/h4-6,9,12H,7-8H2,1-3H3 |
| InChIKey | CDOPMIFFUCFVGY-UHFFFAOYSA-N |
| Density | 0.932g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.612°C at 760 mmHg (Cal.) |
| Flash point | 103.355°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Methylethyl)-2,3-Dihydro-4-Methyl-2-1H-Indene |