|
CAS#: 66353-69-3 Product: [3-Amino-4-(Methylamino)Phenyl] Phenyl Ketone No suppilers available for the product. |
| Name | [3-Amino-4-(Methylamino)Phenyl] Phenyl Ketone |
|---|---|
| Synonyms | (3-Amino-4-Methylamino-Phenyl)-Phenyl-Methanone; (3-Amino-4-(Methylamino)Phenyl) Phenyl Ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 |
| CAS Registry Number | 66353-69-3 |
| EINECS | 266-326-2 |
| SMILES | C2=C(C(=O)C1=CC=CC=C1)C=CC(=C2N)NC |
| InChI | 1S/C14H14N2O/c1-16-13-8-7-11(9-12(13)15)14(17)10-5-3-2-4-6-10/h2-9,16H,15H2,1H3 |
| InChIKey | SFVWUAIFCISEEK-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.631°C at 760 mmHg (Cal.) |
| Flash point | 214.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3-Amino-4-(Methylamino)Phenyl] Phenyl Ketone |