|
CAS#: 6636-47-1 Product: 1-(Carboxymethyl)-9-Methoxy-2-Methyl-3,4,5,6,7,8-Hexahydro-1H-Phenanthrene-2-Carboxylic Acid No suppilers available for the product. |
| Name | 1-(Carboxymethyl)-9-Methoxy-2-Methyl-3,4,5,6,7,8-Hexahydro-1H-Phenanthrene-2-Carboxylic Acid |
|---|---|
| Synonyms | Nsc51554 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 |
| CAS Registry Number | 6636-47-1 |
| SMILES | C2=C(C1=C(CCCC1)C3=C2C(C(C(=O)O)(C)CC3)CC(O)=O)OC |
| InChI | 1S/C19H24O5/c1-19(18(22)23)8-7-12-11-5-3-4-6-13(11)16(24-2)9-14(12)15(19)10-17(20)21/h9,15H,3-8,10H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | GFORJKNNPIYVSZ-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 569.525°C at 760 mmHg (Cal.) |
| Flash point | 205.518°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Carboxymethyl)-9-Methoxy-2-Methyl-3,4,5,6,7,8-Hexahydro-1H-Phenanthrene-2-Carboxylic Acid |