|
CAS#: 6639-01-6 Product: 1-[(2-Naphthylamino)Methylene]-2(1H)-Naphthalenone No suppilers available for the product. |
| Name | 1-[(2-Naphthylamino)Methylene]-2(1H)-Naphthalenone |
|---|---|
| Synonyms | NSC48495; ZINC01104362 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H15NO |
| Molecular Weight | 297.35 |
| CAS Registry Number | 6639-01-6 |
| EINECS | 229-643-7 |
| SMILES | O=C/2C(c1c(cccc1)\C=C\2)=CNc4cc3ccccc3cc4 |
| InChI | 1S/C21H15NO/c23-21-12-10-16-6-3-4-8-19(16)20(21)14-22-18-11-9-15-5-1-2-7-17(15)13-18/h1-14,22H |
| InChIKey | DMPHBMBJGFWFOV-UHFFFAOYSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.544°C at 760 mmHg (Cal.) |
| Flash point | 204.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2-Naphthylamino)Methylene]-2(1H)-Naphthalenone |