|
CAS#: 6639-40-3 Product: 1-Chloro-2-[2-(2-Chlorophenyl)Ethyl]Benzene No suppilers available for the product. |
| Name | 1-Chloro-2-[2-(2-Chlorophenyl)Ethyl]Benzene |
|---|---|
| Synonyms | Nsc16068 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12Cl2 |
| Molecular Weight | 251.15 |
| CAS Registry Number | 6639-40-3 |
| SMILES | C1=CC=CC(=C1CCC2=C(Cl)C=CC=C2)Cl |
| InChI | 1S/C14H12Cl2/c15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16/h1-8H,9-10H2 |
| InChIKey | ZVWAKPJYJPOSRT-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.177°C at 760 mmHg (Cal.) |
| Flash point | 133.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-2-[2-(2-Chlorophenyl)Ethyl]Benzene |