| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2-(3,3,3-Trichloro-1-Propenyl)-Quinoxaline |
|---|---|
| Synonyms | 2-[(E)-3,3,3-Trichloroprop-1-Enyl]Quinoxaline; Nsc48969 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H7Cl3N2 |
| Molecular Weight | 273.55 |
| CAS Registry Number | 6640-58-0 |
| SMILES | C1=CC=CC2=C1N=C(\C=C\C(Cl)(Cl)Cl)C=N2 |
| InChI | 1S/C11H7Cl3N2/c12-11(13,14)6-5-8-7-15-9-3-1-2-4-10(9)16-8/h1-7H/b6-5+ |
| InChIKey | UPAOWTAFCNXMEO-AATRIKPKSA-N |
| Density | 1.477g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.465°C at 760 mmHg (Cal.) |
| Flash point | 221.475°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,3,3-Trichloro-1-Propenyl)-Quinoxaline |