|
CAS#: 6642-26-8 Product: 1H-Purine-8-Methanol No suppilers available for the product. |
| Name | 1H-Purine-8-Methanol |
|---|---|
| Synonyms | Nsc48397; Purine-8-Methanol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 |
| CAS Registry Number | 6642-26-8 |
| SMILES | C1=NC2=C(C=N1)[NH]C(=N2)CO |
| InChI | 1S/C6H6N4O/c11-2-5-9-4-1-7-3-8-6(4)10-5/h1,3,11H,2H2,(H,7,8,9,10) |
| InChIKey | NFZTXJKXCFQRGN-UHFFFAOYSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.992°C at 760 mmHg (Cal.) |
| Flash point | 235.624°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Purine-8-Methanol |