|
CAS#: 66472-85-3 Product: 2-(Acetylseleno)Benzoic Acid No suppilers available for the product. |
| Name | 2-(Acetylseleno)Benzoic Acid |
|---|---|
| Synonyms | 2-(Acetylseleno)Benzoic Acid; 2-Ethanoylselanylbenzoic Acid; Acetylseleno-2 Benzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8O3Se |
| Molecular Weight | 243.12 |
| CAS Registry Number | 66472-85-3 |
| SMILES | C1=CC=CC(=C1C(O)=O)[Se]C(C)=O |
| InChI | 1S/C9H8O3Se/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
| InChIKey | DPMXBHNNOATSAP-UHFFFAOYSA-N |
| Boiling point | 388.589°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 188.812°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Acetylseleno)Benzoic Acid |