|
CAS#: 66537-39-1 Product: Theaspirane A No suppilers available for the product. |
| Name | Theaspirane A |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 66537-39-1 |
| SMILES | [C@H]2(OC1(C(CCC=C1C)(C)C)CC2)C |
| InChI | 1S/C13H22O/c1-10-6-5-8-12(3,4)13(10)9-7-11(2)14-13/h6,11H,5,7-9H2,1-4H3/t11-,13?/m0/s1 |
| InChIKey | GYUZHTWCNKINPY-AMGKYWFPSA-N |
| Density | 0.94g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.122°C at 760 mmHg (Cal.) |
| Flash point | 103.827°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Theaspirane A |