|
CAS#: 66596-46-1 Product: 1-(3,4,5-Trimethoxyphenyl)-4-Methyl-1-Penten-3-Ol No suppilers available for the product. |
| Name | 1-(3,4,5-Trimethoxyphenyl)-4-Methyl-1-Penten-3-Ol |
|---|---|
| Synonyms | 1-Penten-3-Ol, 4-Methyl-1-(3,4,5-Trimethoxyphenyl)-; 4-Methyl-1-(3,4,5-Trimethoxyphenyl)-1-Penten-3-Ol; Brn 2285579 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 66596-46-1 |
| SMILES | C1=C(C(=C(C=C1\C=C\C(C(C)C)O)OC)OC)OC |
| InChI | 1S/C15H22O4/c1-10(2)12(16)7-6-11-8-13(17-3)15(19-5)14(9-11)18-4/h6-10,12,16H,1-5H3/b7-6+ |
| InChIKey | SJWYLBIDXWSXKG-VOTSOKGWSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.983°C at 760 mmHg (Cal.) |
| Flash point | 198.122°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4,5-Trimethoxyphenyl)-4-Methyl-1-Penten-3-Ol |