|
CAS#: 66608-32-0 Product: Imcarbofos No suppilers available for the product. |
| Name | Imcarbofos |
|---|---|
| Synonyms | 3-Diethoxyphosphoryl-1-[4-(Diethoxyphosphorylcarbamothioylamino)-2-Methoxy-Phenyl]Thiourea; 3-Diethoxyphosphoryl-1-[4-[[(Diethoxyphosphorylamino)-Thioxomethyl]Amino]-2-Methoxyphenyl]Thiourea; 3-Diethoxyphosphoryl-1-[4-(Diethoxyphosphorylthiocarbamoylamino)-2-Methoxy-Phenyl]Thiourea |
| Molecular Structure | ![]() |
| Molecular Formula | C17H30N4O7P2S2 |
| Molecular Weight | 528.51 |
| CAS Registry Number | 66608-32-0 |
| SMILES | C1=C(C(=CC(=C1)NC(N[P](OCC)(OCC)=O)=S)OC)NC(N[P](OCC)(OCC)=O)=S |
| InChI | 1S/C17H30N4O7P2S2/c1-6-25-29(22,26-7-2)20-16(31)18-13-10-11-14(15(12-13)24-5)19-17(32)21-30(23,27-8-3)28-9-4/h10-12H,6-9H2,1-5H3,(H2,18,20,22,31)(H2,19,21,23,32) |
| InChIKey | ZEFLNAWBWJVMFX-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.668°C at 760 mmHg (Cal.) |
| Flash point | 295.906°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Imcarbofos |