|
CAS#: 66640-68-4 Product: 4,4'-Bis(Methylsulfonyl)-2,2',5,5'-Tetrachlorobiphenyl No suppilers available for the product. |
| Name | 4,4'-Bis(Methylsulfonyl)-2,2',5,5'-Tetrachlorobiphenyl |
|---|---|
| Synonyms | 1,4-Dichloro-2-(2,5-Dichloro-4-Methylsulfonyl-Phenyl)-5-Methylsulfonyl-Benzene; 1,4-Dichloro-2-(2,5-Dichloro-4-Mesyl-Phenyl)-5-Mesyl-Benzene; 1,1'-Biphenyl, 2,2',5,5'-Tetrachloro-4,4'-Bis(Methylsulfonyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10Cl4O4S2 |
| Molecular Weight | 448.16 |
| CAS Registry Number | 66640-68-4 |
| SMILES | C1=C(C(=CC(=C1Cl)C2=C(C=C(C(=C2)Cl)[S](C)(=O)=O)Cl)Cl)[S](C)(=O)=O |
| InChI | 1S/C14H10Cl4O4S2/c1-23(19,20)13-5-9(15)7(3-11(13)17)8-4-12(18)14(6-10(8)16)24(2,21)22/h3-6H,1-2H3 |
| InChIKey | RDBKPLOYRMCFIY-UHFFFAOYSA-N |
| Density | 1.567g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.18°C at 760 mmHg (Cal.) |
| Flash point | 324.639°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Bis(Methylsulfonyl)-2,2',5,5'-Tetrachlorobiphenyl |