|
CAS#: 6665-19-6 Product: Lysyl-Serine No suppilers available for the product. |
| Name | Lysyl-Serine |
|---|---|
| Synonyms | (2S)-2-[[(2S)-2,6-Diaminohexanoyl]Amino]-3-Hydroxy-Propanoic Acid; (2S)-2-[[(2S)-2,6-Diamino-1-Oxohexyl]Amino]-3-Hydroxypropanoic Acid; (2S)-2-[[(2S)-2,6-Diaminohexanoyl]Amino]-3-Hydroxy-Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H19N3O4 |
| Molecular Weight | 233.27 |
| CAS Registry Number | 6665-19-6 |
| SMILES | [C@@H](NC([C@H](CCCCN)N)=O)(C(O)=O)CO |
| InChI | 1S/C9H19N3O4/c10-4-2-1-3-6(11)8(14)12-7(5-13)9(15)16/h6-7,13H,1-5,10-11H2,(H,12,14)(H,15,16)/t6-,7-/m0/s1 |
| InChIKey | YSZNURNVYFUEHC-BQBZGAKWSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 561.616°C at 760 mmHg (Cal.) |
| Flash point | 293.455°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lysyl-Serine |