|
CAS#: 6665-99-2 Product: cytidine diphosphate glycerol No suppilers available for the product. |
| Name | cytidine diphosphate glycerol |
|---|---|
| Synonyms | cytidine diphosphate glycerol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H23N3O14P2 |
| Molecular Weight | 495.27 |
| CAS Registry Number | 6665-99-2 |
| SMILES | OCC(O)CO.OP(=O)(O)OP(O)(=O)OC[C@H]2O[C@@H](N1/C=C\C(\N)=N/C1=O)[C@H](O)[C@@H]2O |
| InChI | 1S/C9H15N3O11P2.C3H8O3/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18;4-1-3(6)2-5/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H2,10,11,15)(H2,16,17,18);3-6H,1-2H2/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | ZAICJVQBTFUIFO-IAIGYFSYSA-N |
| Boiling point | 914.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 507°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cytidine diphosphate glycerol |