| Name | 1,2-Bis(2,2-Dimethylpropyl)-3,4,5,6-Tetramethyl-Benzene |
|---|---|
| Synonyms | 1,2-Bis(2,2-Dimethylpropyl)-3,4,5,6-Tetramethyl-Benzene; 1,2,3,4-Tetramethyl-5,6-Dineopentyl-Benzene; 1,2,3,4-Tetramethyl-5,6-Di(2,2-Dimethylpropyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 |
| CAS Registry Number | 6668-20-8 |
| SMILES | C(C(C)(C)C)C1=C(CC(C)(C)C)C(=C(C(=C1C)C)C)C |
| InChI | 1S/C20H34/c1-13-14(2)16(4)18(12-20(8,9)10)17(15(13)3)11-19(5,6)7/h11-12H2,1-10H3 |
| InChIKey | ULDLEROKNIHNLZ-UHFFFAOYSA-N |
| Density | 0.86g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.741°C at 760 mmHg (Cal.) |
| Flash point | 167.373°C (Cal.) |
| (1) | R. E. Gerkin. Dineopentylprehnitene (1,2,3,4-tetramethyl-5,6-dineopentylbenzene) at 296 and 223K, Acta Cryst. (1999). C55, 79-82 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(2,2-Dimethylpropyl)-3,4,5,6-Tetramethyl-Benzene |