|
CAS#: 66708-26-7 Product: 3-Isobutyl-7a-methyl-2,4,5,6,7,7a-hexahydro-1H-indene No suppilers available for the product. |
| Name | 3-Isobutyl-7a-methyl-2,4,5,6,7,7a-hexahydro-1H-indene |
|---|---|
| Synonyms | 1-Methyl-7-(2'-methylpropyl)bicyclo[4.3.0]nonan-6-ene; 3-Isobutyl-7a-methyl-2,4,5,6,7,7a-hexahydro-1H-indene # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.34 |
| CAS Registry Number | 66708-26-7 |
| SMILES | C\21=C(/CCC1(CCCC/2)C)CC(C)C |
| InChI | 1S/C14H24/c1-11(2)10-12-7-9-14(3)8-5-4-6-13(12)14/h11H,4-10H2,1-3H3 |
| InChIKey | BPTHDNDBUOBTAC-UHFFFAOYSA-N |
| Density | 0.89g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.306°C at 760 mmHg (Cal.) |
| Flash point | 94.904°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Isobutyl-7a-methyl-2,4,5,6,7,7a-hexahydro-1H-indene |