|
CAS#: 66748-90-1 Product: Threonine Tert-Butyl Ester No suppilers available for the product. |
| Name | Threonine Tert-Butyl Ester |
|---|---|
| Synonyms | Tert-Butyl (2S,3R)-2-Amino-3-Hydroxy-Butanoate; (2S,3R)-2-Amino-3-Hydroxybutanoic Acid Tert-Butyl Ester; (2S,3R)-2-Amino-3-Hydroxy-Butyric Acid Tert-Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 |
| CAS Registry Number | 66748-90-1 |
| SMILES | [C@H](C(=O)OC(C)(C)C)(N)[C@@H](C)O |
| InChI | 1S/C8H17NO3/c1-5(10)6(9)7(11)12-8(2,3)4/h5-6,10H,9H2,1-4H3/t5-,6+/m1/s1 |
| InChIKey | XASPGLPXANLVTJ-RITPCOANSA-N |
| Density | 1.055g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.051°C at 760 mmHg (Cal.) |
| Flash point | 118.332°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Threonine Tert-Butyl Ester |