|
CAS#: 66759-48-6 Product: Desocriptine No suppilers available for the product. |
| Name | Desocriptine |
|---|---|
| Synonyms | 6'-Deoxo-9,10Alpha-Dihydro-Beta-Ergocryptine; Desocriptine; Desocriptine [Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C32H45N5O4 |
| Molecular Weight | 563.74 |
| CAS Registry Number | 66759-48-6 |
| SMILES | [C@@]56(N(C([C@@](NC([C@@H]4C[C@@H]3C1=CC=CC2=C1C(=C[NH]2)C[C@@H]3N(C4)C)=O)(C(C)C)O5)=O)[C@H](CN7[C@H]6CCC7)[C@H](CC)C)O |
| InChI | 1S/C32H45N5O4/c1-6-19(4)26-17-36-12-8-11-27(36)32(40)37(26)30(39)31(41-32,18(2)3)34-29(38)21-13-23-22-9-7-10-24-28(22)20(15-33-24)14-25(23)35(5)16-21/h7,9-10,15,18-19,21,23,25-27,33,40H,6,8,11-14,16-17H2,1-5H3,(H,34,38)/t19-,21+,23+,25-,26+,27-,31+,32-/m0/s1 |
| InChIKey | OPAVODIYXVLOOM-XAOZLXPPSA-N |
| Density | 1.319g/cm3 (Cal.) |
|---|---|
| Boiling point | 793.695°C at 760 mmHg (Cal.) |
| Flash point | 433.812°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Desocriptine |