|
CAS#: 66796-48-3 Product: Bis(2,4-Dichlorophenyl)Ethyl Phosphate No suppilers available for the product. |
| Name | Bis(2,4-Dichlorophenyl)Ethyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Bis(2,4-Dichlorophenyl) Ethyl Ester; Bis(2,4-Dichlorophenyl)Ethyl Phosphate (8Ci)(9Ci); Edp |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11Cl4O4P |
| Molecular Weight | 416.02 |
| CAS Registry Number | 66796-48-3 (36519-00-3) |
| SMILES | C1=C(C(=CC=C1Cl)O[P](=O)(OCC)OC2=CC=C(C=C2Cl)Cl)Cl |
| InChI | 1S/C14H11Cl4O4P/c1-2-20-23(19,21-13-5-3-9(15)7-11(13)17)22-14-6-4-10(16)8-12(14)18/h3-8H,2H2,1H3 |
| InChIKey | HEMINMLPKZELPP-UHFFFAOYSA-N |
| Density | 1.504g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.363°C at 760 mmHg (Cal.) |
| Flash point | 364.698°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2,4-Dichlorophenyl)Ethyl Phosphate |