|
CAS#: 66859-52-7 Product: 2-(2-Butenylthio)-2-Ethylbutyramide No suppilers available for the product. |
| Name | 2-(2-Butenylthio)-2-Ethylbutyramide |
|---|---|
| Synonyms | 2-[(E)-But-2-Enyl]Sulfanyl-2-Ethyl-Butanamide; 2-[[(E)-But-2-Enyl]Thio]-2-Ethylbutanamide; 2-[[(E)-But-2-Enyl]Thio]-2-Ethyl-Butyramide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 |
| CAS Registry Number | 66859-52-7 |
| SMILES | C(C(SC\C=C\C)(C(=O)N)CC)C |
| InChI | 1S/C10H19NOS/c1-4-7-8-13-10(5-2,6-3)9(11)12/h4,7H,5-6,8H2,1-3H3,(H2,11,12)/b7-4+ |
| InChIKey | IMVOLHSWOSQRCD-QPJJXVBHSA-N |
| Density | 0.997g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.452°C at 760 mmHg (Cal.) |
| Flash point | 150.628°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Butenylthio)-2-Ethylbutyramide |